C28H35BrN2O4S — CID 127037963
(1R,4aS,9E,10aR)-6-bromo-1,4a-dimethyl-7-propan-2-yl-9-[3-(thiophene-2-carbonylamino)propoxyimino]-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 127037963) has the molecular formula C28H35BrN2O4S and a molecular weight of 575.57 g/mol. Its IUPAC name is (1R,4aS,9E,10aR)-6-bromo-1,4a-dimethyl-7-propan-2-yl-9-[3-(thiophene-2-carbonylamino)propoxyimino]-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,9E,10aR)-6-bromo-1,4a-dimethyl-7-propan-2-yl-9-[3-(thiophene-2-carbonylamino)propoxyimino]-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 127037963 |
| Molecular Formula | C28H35BrN2O4S |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | (1R,4aS,9E,10aR)-6-bromo-1,4a-dimethyl-7-propan-2-yl-9-[3-(thiophene-2-carbonylamino)propoxyimino]-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1Br)[C@@]1(C)CCC[C@@](C)(C(=O)O)[C@@H]1C/C2=N\OCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C28H35BrN2O4S/c1-17(2)18-14-19-20(15-21(18)29)27(3)9-6-10-28(4,26(33)34)24(27)16-22(19)31-35-12-7-11-30-25(32)23-8-5-13-36-23/h5,8,13-15,17,24H,6-7,9-12,16H2,1-4H3,(H,30,32)(H,33,34)/b31-22+/t24-,27-,28-/m1/s1 |
| InChIKey | KVKSEVSIFIHAPQ-FSRAXSAZSA-N |
| XLogP | 6.73 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|