C30H39BrN2O4S — CID 127037964
(1R,4aS,9E,10aR)-6-bromo-1,4a-dimethyl-7-propan-2-yl-9-[5-(thiophene-2-carbonylamino)pentoxyimino]-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 127037964) has the molecular formula C30H39BrN2O4S and a molecular weight of 603.62 g/mol. Its IUPAC name is (1R,4aS,9E,10aR)-6-bromo-1,4a-dimethyl-7-propan-2-yl-9-[5-(thiophene-2-carbonylamino)pentoxyimino]-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,9E,10aR)-6-bromo-1,4a-dimethyl-7-propan-2-yl-9-[5-(thiophene-2-carbonylamino)pentoxyimino]-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 127037964 |
| Molecular Formula | C30H39BrN2O4S |
| Molecular Weight | 603.62 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | (1R,4aS,9E,10aR)-6-bromo-1,4a-dimethyl-7-propan-2-yl-9-[5-(thiophene-2-carbonylamino)pentoxyimino]-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1Br)[C@@]1(C)CCC[C@@](C)(C(=O)O)[C@@H]1C/C2=N\OCCCCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C30H39BrN2O4S/c1-19(2)20-16-21-22(17-23(20)31)29(3)11-9-12-30(4,28(35)36)26(29)18-24(21)33-37-14-7-5-6-13-32-27(34)25-10-8-15-38-25/h8,10,15-17,19,26H,5-7,9,11-14,18H2,1-4H3,(H,32,34)(H,35,36)/b33-24+/t26-,29-,30-/m1/s1 |
| InChIKey | AWBYTKMAFBRFFF-UKNWRCAOSA-N |
| XLogP | 7.51 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.62 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|