About [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine
[4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine (PubChem CID 127038022) has the molecular formula C18H16ClN3
and a molecular weight of 309.80 g/mol. Its IUPAC name is [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine |
| PubChem CID | 127038022 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine |
| SMILES | NCc1ccc(-c2nc3ccc(Cl)cc3c3c2CCN3)cc1 |
| InChI | InChI=1S/C18H16ClN3/c19-13-5-6-16-15(9-13)18-14(7-8-21-18)17(22-16)12-3-1-11(10-20)2-4-12/h1-6,9,21H,7-8,10,20H2 |
| InChIKey | WYWTTYYXMZXPHD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine?
The IUPAC name of [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine (CID 127038022) is [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine.
What is the SMILES notation for [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine?
The canonical SMILES for [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine is NCc1ccc(-c2nc3ccc(Cl)cc3c3c2CCN3)cc1.
What is the InChIKey of [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine?
The InChIKey is WYWTTYYXMZXPHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3/c19-13-5-6-16-15(9-13)18-14(7-8-21-18)17(22-16)12-3-1-11(10-20)2-4-12/h1-6,9,21H,7-8,10,20H2.
What are the key properties of [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine?
[4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine has a molecular weight of 309.80 g/mol, XLogP of 3.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(8-chloro-2,3-dihydro-1H-pyrrolo[3,2-c]quinolin-4-yl)phenyl]methanamine is sourced from PubChem (CID 127038022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).