C22H26Cl3N5O — CID 127038076
N-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,2,4-oxadiazol-3-amine;hydrochloride (PubChem CID 127038076) has the molecular formula C22H26Cl3N5O and a molecular weight of 482.84 g/mol. Its IUPAC name is N-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,2,4-oxadiazol-3-amine;hydrochloride.
| Compound Name | N-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,2,4-oxadiazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 127038076 |
| Molecular Formula | C22H26Cl3N5O |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | N-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,2,4-oxadiazol-3-amine;hydrochloride |
| SMILES | Cl.Clc1ccc(N2CCN(CCCCNc3noc(-c4ccccc4)n3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H25Cl2N5O.ClH/c23-18-8-9-20(19(24)16-18)29-14-12-28(13-15-29)11-5-4-10-25-22-26-21(30-27-22)17-6-2-1-3-7-17;/h1-3,6-9,16H,4-5,10-15H2,(H,25,27);1H |
| InChIKey | STYCWWIKECWBBA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|