C22H27Cl2N5O — CID 127038078
N-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,2,4-oxadiazol-3-amine;hydrochloride (PubChem CID 127038078) has the molecular formula C22H27Cl2N5O and a molecular weight of 448.40 g/mol. Its IUPAC name is N-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,2,4-oxadiazol-3-amine;hydrochloride.
| Compound Name | N-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,2,4-oxadiazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 127038078 |
| Molecular Formula | C22H27Cl2N5O |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-[4-[4-(4-chlorophenyl)piperazin-1-yl]butyl]-5-phenyl-1,2,4-oxadiazol-3-amine;hydrochloride |
| SMILES | Cl.Clc1ccc(N2CCN(CCCCNc3noc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C22H26ClN5O.ClH/c23-19-8-10-20(11-9-19)28-16-14-27(15-17-28)13-5-4-12-24-22-25-21(29-26-22)18-6-2-1-3-7-18;/h1-3,6-11H,4-5,12-17H2,(H,24,26);1H |
| InChIKey | IPLCAXSRUDGODP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|