C29H42N4O6 — CID 127038156
(3S,6S,9R,12S,16R)-9-methyl-16-[(E)-2-phenylethenyl]-3,6,12-tri(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone (PubChem CID 127038156) has the molecular formula C29H42N4O6 and a molecular weight of 542.68 g/mol. Its IUPAC name is (3S,6S,9R,12S,16R)-9-methyl-16-[(E)-2-phenylethenyl]-3,6,12-tri(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone.
| Compound Name | (3S,6S,9R,12S,16R)-9-methyl-16-[(E)-2-phenylethenyl]-3,6,12-tri(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone |
|---|---|
| PubChem CID | 127038156 |
| Molecular Formula | C29H42N4O6 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | (3S,6S,9R,12S,16R)-9-methyl-16-[(E)-2-phenylethenyl]-3,6,12-tri(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadecane-2,5,8,11,14-pentone |
| SMILES | CC(C)[C@@H]1NC(=O)C[C@H](/C=C/c2ccccc2)OC(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C29H42N4O6/c1-16(2)23-27(36)30-19(7)26(35)32-24(17(3)4)28(37)33-25(18(5)6)29(38)39-21(15-22(34)31-23)14-13-20-11-9-8-10-12-20/h8-14,16-19,21,23-25H,15H2,1-7H3,(H,30,36)(H,31,34)(H,32,35)(H,33,37)/b14-13+/t19-,21+,23+,24+,25+/m1/s1 |
| InChIKey | YCQYXHBWHHEYIM-DNSLKWDESA-N |
| XLogP | 1.94 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |