About ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate
ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate (PubChem CID 127038194) has the molecular formula C14H15NO4
and a molecular weight of 261.28 g/mol. Its IUPAC name is ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate |
| PubChem CID | 127038194 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate |
| SMILES | CCOC(=O)C1=C(OCc2ccccc2)C(=O)NC1 |
| InChI | InChI=1S/C14H15NO4/c1-2-18-14(17)11-8-15-13(16)12(11)19-9-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,15,16) |
| InChIKey | GOLVXMINNOJNRM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate?
The IUPAC name of ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate (CID 127038194) is ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate.
What is the SMILES notation for ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate?
The canonical SMILES for ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate is CCOC(=O)C1=C(OCc2ccccc2)C(=O)NC1.
What is the InChIKey of ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate?
The InChIKey is GOLVXMINNOJNRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4/c1-2-18-14(17)11-8-15-13(16)12(11)19-9-10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,15,16).
What are the key properties of ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate?
ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate has a molecular weight of 261.28 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-oxo-4-phenylmethoxy-1,2-dihydropyrrole-3-carboxylate is sourced from PubChem (CID 127038194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).