C23H26N6O4 — CID 127038244
N-(2-aminoethyl)-4,11-bis(2-aminoethylamino)-5,10-dioxonaphtho[2,3-f][1]benzofuran-2-carboxamide (PubChem CID 127038244) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-(2-aminoethyl)-4,11-bis(2-aminoethylamino)-5,10-dioxonaphtho[2,3-f][1]benzofuran-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-4,11-bis(2-aminoethylamino)-5,10-dioxonaphtho[2,3-f][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 127038244 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | N-(2-aminoethyl)-4,11-bis(2-aminoethylamino)-5,10-dioxonaphtho[2,3-f][1]benzofuran-2-carboxamide |
| SMILES | NCCNC(=O)c1cc2c(NCCN)c3c(c(NCCN)c2o1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C23H26N6O4/c24-5-8-27-18-14-11-15(23(32)29-10-7-26)33-22(14)19(28-9-6-25)17-16(18)20(30)12-3-1-2-4-13(12)21(17)31/h1-4,11,27-28H,5-10,24-26H2,(H,29,32) |
| InChIKey | GKDCOAWDHYRNED-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 178.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|