About 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione
1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione (PubChem CID 127038254) has the molecular formula C19H24ClN3O3
and a molecular weight of 377.87 g/mol. Its IUPAC name is 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione |
| PubChem CID | 127038254 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione |
| SMILES | CC(C(=O)N1CCN(c2cccc(Cl)c2)CC1)N1C(=O)CC(C)(C)C1=O |
| InChI | InChI=1S/C19H24ClN3O3/c1-13(23-16(24)12-19(2,3)18(23)26)17(25)22-9-7-21(8-10-22)15-6-4-5-14(20)11-15/h4-6,11,13H,7-10,12H2,1-3H3 |
| InChIKey | HURNTMVFWQRKKH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione?
The IUPAC name of 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione (CID 127038254) is 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione.
What is the SMILES notation for 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione?
The canonical SMILES for 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione is CC(C(=O)N1CCN(c2cccc(Cl)c2)CC1)N1C(=O)CC(C)(C)C1=O.
What is the InChIKey of 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione?
The InChIKey is HURNTMVFWQRKKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24ClN3O3/c1-13(23-16(24)12-19(2,3)18(23)26)17(25)22-9-7-21(8-10-22)15-6-4-5-14(20)11-15/h4-6,11,13H,7-10,12H2,1-3H3.
What are the key properties of 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione?
1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione has a molecular weight of 377.87 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[4-(3-chlorophenyl)piperazin-1-yl]-1-oxopropan-2-yl]-3,3-dimethylpyrrolidine-2,5-dione is sourced from PubChem (CID 127038254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).