About 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid
2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid (PubChem CID 127038373) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid |
| PubChem CID | 127038373 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid |
| SMILES | CC(C)N1C(=O)CN(Cc2ccc(-c3ccc(CC(=O)O)cc3)cc2)C1=O |
| InChI | InChI=1S/C21H22N2O4/c1-14(2)23-19(24)13-22(21(23)27)12-16-5-9-18(10-6-16)17-7-3-15(4-8-17)11-20(25)26/h3-10,14H,11-13H2,1-2H3,(H,25,26) |
| InChIKey | BZTOMIXEKSHYGP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid?
The IUPAC name of 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid (CID 127038373) is 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid.
What is the SMILES notation for 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid?
The canonical SMILES for 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid is CC(C)N1C(=O)CN(Cc2ccc(-c3ccc(CC(=O)O)cc3)cc2)C1=O.
What is the InChIKey of 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid?
The InChIKey is BZTOMIXEKSHYGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4/c1-14(2)23-19(24)13-22(21(23)27)12-16-5-9-18(10-6-16)17-7-3-15(4-8-17)11-20(25)26/h3-10,14H,11-13H2,1-2H3,(H,25,26).
What are the key properties of 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid?
2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid has a molecular weight of 366.42 g/mol, XLogP of 3.15, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-[(2,4-dioxo-3-propan-2-ylimidazolidin-1-yl)methyl]phenyl]phenyl]acetic acid is sourced from PubChem (CID 127038373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).