C31H27N3O — CID 127038396
1-[3-[(6S,10R)-6-(1H-indol-3-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-yl]indol-1-yl]ethanone (PubChem CID 127038396) has the molecular formula C31H27N3O and a molecular weight of 457.58 g/mol. Its IUPAC name is 1-[3-[(6S,10R)-6-(1H-indol-3-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-yl]indol-1-yl]ethanone.
| Compound Name | 1-[3-[(6S,10R)-6-(1H-indol-3-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-yl]indol-1-yl]ethanone |
|---|---|
| PubChem CID | 127038396 |
| Molecular Formula | C31H27N3O |
| Molecular Weight | 457.58 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 1-[3-[(6S,10R)-6-(1H-indol-3-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indol-10-yl]indol-1-yl]ethanone |
| SMILES | CC(=O)n1cc([C@H]2CCC[C@@H](c3c[nH]c4ccccc34)c3[nH]c4ccccc4c32)c2ccccc21 |
| InChI | InChI=1S/C31H27N3O/c1-19(35)34-18-26(21-10-4-7-16-29(21)34)22-12-8-13-23(25-17-32-27-14-5-2-9-20(25)27)31-30(22)24-11-3-6-15-28(24)33-31/h2-7,9-11,14-18,22-23,32-33H,8,12-13H2,1H3/t22-,23+/m1/s1 |
| InChIKey | RRUTUQGGIJKSQK-PKTZIBPZSA-N |
| XLogP | 7.71 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.58 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |