C18H11F6N3O2 — CID 127038403
2-pyridin-2-yl-4-(2,2,2-trifluoroethoxy)-6-[(2,3,4-trifluorophenoxy)methyl]pyrimidine (PubChem CID 127038403) has the molecular formula C18H11F6N3O2 and a molecular weight of 415.29 g/mol. Its IUPAC name is 2-pyridin-2-yl-4-(2,2,2-trifluoroethoxy)-6-[(2,3,4-trifluorophenoxy)methyl]pyrimidine.
| Compound Name | 2-pyridin-2-yl-4-(2,2,2-trifluoroethoxy)-6-[(2,3,4-trifluorophenoxy)methyl]pyrimidine |
|---|---|
| PubChem CID | 127038403 |
| Molecular Formula | C18H11F6N3O2 |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-pyridin-2-yl-4-(2,2,2-trifluoroethoxy)-6-[(2,3,4-trifluorophenoxy)methyl]pyrimidine |
| SMILES | Fc1ccc(OCc2cc(OCC(F)(F)F)nc(-c3ccccn3)n2)c(F)c1F |
| InChI | InChI=1S/C18H11F6N3O2/c19-11-4-5-13(16(21)15(11)20)28-8-10-7-14(29-9-18(22,23)24)27-17(26-10)12-3-1-2-6-25-12/h1-7H,8-9H2 |
| InChIKey | AUAOGLNQKWNYCN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|