C20H28O3 — CID 127038496
1-[(4bS,7S,8aR)-7-hydroxy-3-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]ethanone (PubChem CID 127038496) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-[(4bS,7S,8aR)-7-hydroxy-3-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]ethanone.
| Compound Name | 1-[(4bS,7S,8aR)-7-hydroxy-3-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]ethanone |
|---|---|
| PubChem CID | 127038496 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-[(4bS,7S,8aR)-7-hydroxy-3-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthren-2-yl]ethanone |
| SMILES | COc1cc2c(cc1C(C)=O)CC[C@H]1C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C20H28O3/c1-12(21)14-10-13-6-7-17-19(2,3)18(22)8-9-20(17,4)15(13)11-16(14)23-5/h10-11,17-18,22H,6-9H2,1-5H3/t17-,18-,20+/m0/s1 |
| InChIKey | BPHDPDCFQCADLJ-CMKODMSKSA-N |
| XLogP | 3.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |