C15H22O2 — CID 127038500
(3aS,4S)-2,2,4,6-tetramethylspiro[3H-indene-5,1'-cyclopropane]-3a,4-diol (PubChem CID 127038500) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3aS,4S)-2,2,4,6-tetramethylspiro[3H-indene-5,1'-cyclopropane]-3a,4-diol.
| Compound Name | (3aS,4S)-2,2,4,6-tetramethylspiro[3H-indene-5,1'-cyclopropane]-3a,4-diol |
|---|---|
| PubChem CID | 127038500 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3aS,4S)-2,2,4,6-tetramethylspiro[3H-indene-5,1'-cyclopropane]-3a,4-diol |
| SMILES | CC1=CC2=CC(C)(C)C[C@@]2(O)[C@@](C)(O)C12CC2 |
| InChI | InChI=1S/C15H22O2/c1-10-7-11-8-12(2,3)9-15(11,17)13(4,16)14(10)5-6-14/h7-8,16-17H,5-6,9H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | QBVVHCHYSZWSDG-ZFWWWQNUSA-N |
| XLogP | 2.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |