C23H17F2N5O — CID 127038508
1,8-bis(2-fluoro-4-pyridinyl)-6-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline (PubChem CID 127038508) has the molecular formula C23H17F2N5O and a molecular weight of 417.42 g/mol. Its IUPAC name is 1,8-bis(2-fluoro-4-pyridinyl)-6-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline.
| Compound Name | 1,8-bis(2-fluoro-4-pyridinyl)-6-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline |
|---|---|
| PubChem CID | 127038508 |
| Molecular Formula | C23H17F2N5O |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1,8-bis(2-fluoro-4-pyridinyl)-6-methoxy-3,4-dimethylimidazo[1,5-a]quinoxaline |
| SMILES | COc1cc(-c2ccnc(F)c2)cc2c1nc(C)c1c(C)nc(-c3ccnc(F)c3)n12 |
| InChI | InChI=1S/C23H17F2N5O/c1-12-22-13(2)29-23(15-5-7-27-20(25)11-15)30(22)17-8-16(9-18(31-3)21(17)28-12)14-4-6-26-19(24)10-14/h4-11H,1-3H3 |
| InChIKey | SMBDWRLHTIVDJR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 65.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|