About 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone
1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone (PubChem CID 127038800) has the molecular formula C21H21N5O
and a molecular weight of 359.43 g/mol. Its IUPAC name is 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone |
| PubChem CID | 127038800 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone |
| SMILES | CC(=O)c1cc(-c2cccc3nccn23)c2cc(N3CCNCC3)ccn12 |
| InChI | InChI=1S/C21H21N5O/c1-15(27)19-14-17(18-3-2-4-21-23-8-12-26(18)21)20-13-16(5-9-25(19)20)24-10-6-22-7-11-24/h2-5,8-9,12-14,22H,6-7,10-11H2,1H3 |
| InChIKey | MHEJXHKUTMYLLU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone?
The IUPAC name of 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone (CID 127038800) is 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone.
What is the SMILES notation for 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone?
The canonical SMILES for 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone is CC(=O)c1cc(-c2cccc3nccn23)c2cc(N3CCNCC3)ccn12.
What is the InChIKey of 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone?
The InChIKey is MHEJXHKUTMYLLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O/c1-15(27)19-14-17(18-3-2-4-21-23-8-12-26(18)21)20-13-16(5-9-25(19)20)24-10-6-22-7-11-24/h2-5,8-9,12-14,22H,6-7,10-11H2,1H3.
What are the key properties of 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone?
1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone has a molecular weight of 359.43 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-imidazo[1,2-a]pyridin-5-yl-7-piperazin-1-ylindolizin-3-yl)ethanone is sourced from PubChem (CID 127038800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).