C28H29FN2O2 — CID 127038823
3-[4-(5,6-dimethoxy-1,3-dihydroisoindol-2-yl)butyl]-1-(4-fluorophenyl)indole (PubChem CID 127038823) has the molecular formula C28H29FN2O2 and a molecular weight of 444.55 g/mol. Its IUPAC name is 3-[4-(5,6-dimethoxy-1,3-dihydroisoindol-2-yl)butyl]-1-(4-fluorophenyl)indole.
| Compound Name | 3-[4-(5,6-dimethoxy-1,3-dihydroisoindol-2-yl)butyl]-1-(4-fluorophenyl)indole |
|---|---|
| PubChem CID | 127038823 |
| Molecular Formula | C28H29FN2O2 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 3-[4-(5,6-dimethoxy-1,3-dihydroisoindol-2-yl)butyl]-1-(4-fluorophenyl)indole |
| SMILES | COc1cc2c(cc1OC)CN(CCCCc1cn(-c3ccc(F)cc3)c3ccccc13)C2 |
| InChI | InChI=1S/C28H29FN2O2/c1-32-27-15-21-17-30(18-22(21)16-28(27)33-2)14-6-5-7-20-19-31(24-12-10-23(29)11-13-24)26-9-4-3-8-25(20)26/h3-4,8-13,15-16,19H,5-7,14,17-18H2,1-2H3 |
| InChIKey | LFGGJVUOGAFMML-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|