C17H14N2O — CID 127038911
(1E,4E,6E)-1,7-dipyridin-3-ylhepta-1,4,6-trien-3-one (PubChem CID 127038911) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is (1E,4E,6E)-1,7-dipyridin-3-ylhepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E,6E)-1,7-dipyridin-3-ylhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 127038911 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (1E,4E,6E)-1,7-dipyridin-3-ylhepta-1,4,6-trien-3-one |
| SMILES | O=C(/C=C/C=C/c1cccnc1)/C=C/c1cccnc1 |
| InChI | InChI=1S/C17H14N2O/c20-17(10-9-16-7-4-12-19-14-16)8-2-1-5-15-6-3-11-18-13-15/h1-14H/b5-1+,8-2+,10-9+ |
| InChIKey | WOBWFONGNWWTEG-TUZUNUKESA-N |
| XLogP | 3.33 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|