About 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine
3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine (PubChem CID 127038924) has the molecular formula C15H13ClN4
and a molecular weight of 284.75 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine |
| PubChem CID | 127038924 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine |
| SMILES | Cc1cc(C)n(-c2ccc(-c3ccc(Cl)cc3)nn2)n1 |
| InChI | InChI=1S/C15H13ClN4/c1-10-9-11(2)20(19-10)15-8-7-14(17-18-15)12-3-5-13(16)6-4-12/h3-9H,1-2H3 |
| InChIKey | DJBUCMQPADJSPF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine?
The IUPAC name of 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine (CID 127038924) is 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine.
What is the SMILES notation for 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine?
The canonical SMILES for 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine is Cc1cc(C)n(-c2ccc(-c3ccc(Cl)cc3)nn2)n1.
What is the InChIKey of 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine?
The InChIKey is DJBUCMQPADJSPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4/c1-10-9-11(2)20(19-10)15-8-7-14(17-18-15)12-3-5-13(16)6-4-12/h3-9H,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine?
3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine has a molecular weight of 284.75 g/mol, XLogP of 3.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-6-(3,5-dimethylpyrazol-1-yl)pyridazine is sourced from PubChem (CID 127038924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).