C18H39N3O — CID 127038932
(2S)-2,4-diamino-N-tetradecylbutanamide (PubChem CID 127038932) has the molecular formula C18H39N3O and a molecular weight of 313.53 g/mol. Its IUPAC name is (2S)-2,4-diamino-N-tetradecylbutanamide.
| Compound Name | (2S)-2,4-diamino-N-tetradecylbutanamide |
|---|---|
| PubChem CID | 127038932 |
| Molecular Formula | C18H39N3O |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.31 |
| IUPAC Name | (2S)-2,4-diamino-N-tetradecylbutanamide |
| SMILES | CCCCCCCCCCCCCCNC(=O)[C@@H](N)CCN |
| InChI | InChI=1S/C18H39N3O/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21-18(22)17(20)14-15-19/h17H,2-16,19-20H2,1H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | QZGKAIDLGNZEGE-KRWDZBQOSA-N |
| XLogP | 3.48 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|