C14H22BrIN2 — CID 127039016
4-(3-bromophenyl)-1,1-diethylpiperazin-1-ium iodide (PubChem CID 127039016) has the molecular formula C14H22BrIN2 and a molecular weight of 425.15 g/mol. Its IUPAC name is 4-(3-bromophenyl)-1,1-diethylpiperazin-1-ium iodide.
| Compound Name | 4-(3-bromophenyl)-1,1-diethylpiperazin-1-ium iodide |
|---|---|
| PubChem CID | 127039016 |
| Molecular Formula | C14H22BrIN2 |
| Molecular Weight | 425.15 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 4-(3-bromophenyl)-1,1-diethylpiperazin-1-ium iodide |
| SMILES | CC[N+]1(CC)CCN(c2cccc(Br)c2)CC1.[I-] |
| InChI | InChI=1S/C14H22BrN2.HI/c1-3-17(4-2)10-8-16(9-11-17)14-7-5-6-13(15)12-14;/h5-7,12H,3-4,8-11H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | NZHCTUZRWCGKSY-UHFFFAOYSA-M |
| XLogP | 0.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.15 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|