C25H26N4O2 — CID 127039038
N-[(1S,2S)-2-hydroxycyclohexyl]-1-[(4-pyrazol-1-ylphenyl)methyl]indole-3-carboxamide (PubChem CID 127039038) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-1-[(4-pyrazol-1-ylphenyl)methyl]indole-3-carboxamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-1-[(4-pyrazol-1-ylphenyl)methyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 127039038 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-1-[(4-pyrazol-1-ylphenyl)methyl]indole-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCC[C@@H]1O)c1cn(Cc2ccc(-n3cccn3)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H26N4O2/c30-24-9-4-2-7-22(24)27-25(31)21-17-28(23-8-3-1-6-20(21)23)16-18-10-12-19(13-11-18)29-15-5-14-26-29/h1,3,5-6,8,10-15,17,22,24,30H,2,4,7,9,16H2,(H,27,31)/t22-,24-/m0/s1 |
| InChIKey | DOTYFYMBJHPLRJ-UPVQGACJSA-N |
| XLogP | 3.91 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |