About 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid
2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid (PubChem CID 127039154) has the molecular formula C23H17N3O7S
and a molecular weight of 479.47 g/mol. Its IUPAC name is 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid.
Molecular Properties
| Compound Name | 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid |
| PubChem CID | 127039154 |
| Molecular Formula | C23H17N3O7S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(CN2C(=O)c3ccc(C(=O)Nc4ccccc4C(=O)O)cc3C2=O)cc1 |
| InChI | InChI=1S/C23H17N3O7S/c24-34(32,33)15-8-5-13(6-9-15)12-26-21(28)16-10-7-14(11-18(16)22(26)29)20(27)25-19-4-2-1-3-17(19)23(30)31/h1-11H,12H2,(H,25,27)(H,30,31)(H2,24,32,33) |
| InChIKey | KJLIUNMQXVHGKJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 163.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_acid_B(3)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid?
The IUPAC name of 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid (CID 127039154) is 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid.
What is the SMILES notation for 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid?
The canonical SMILES for 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid is NS(=O)(=O)c1ccc(CN2C(=O)c3ccc(C(=O)Nc4ccccc4C(=O)O)cc3C2=O)cc1.
What is the InChIKey of 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid?
The InChIKey is KJLIUNMQXVHGKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17N3O7S/c24-34(32,33)15-8-5-13(6-9-15)12-26-21(28)16-10-7-14(11-18(16)22(26)29)20(27)25-19-4-2-1-3-17(19)23(30)31/h1-11H,12H2,(H,25,27)(H,30,31)(H2,24,32,33).
What are the key properties of 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid?
2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid has a molecular weight of 479.47 g/mol, XLogP of 2.08, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1,3-dioxo-2-[(4-sulfamoylphenyl)methyl]isoindole-5-carbonyl]amino]benzoic acid is sourced from PubChem (CID 127039154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).