About (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide
(2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide (PubChem CID 127039202) has the molecular formula C13H17F2N3O3
and a molecular weight of 301.29 g/mol. Its IUPAC name is (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide.
Molecular Properties
| Compound Name | (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide |
| PubChem CID | 127039202 |
| Molecular Formula | C13H17F2N3O3 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide |
| SMILES | CC(C)C[C@H](NC(=O)Nc1c(F)cccc1F)C(=O)NO |
| InChI | InChI=1S/C13H17F2N3O3/c1-7(2)6-10(12(19)18-21)16-13(20)17-11-8(14)4-3-5-9(11)15/h3-5,7,10,21H,6H2,1-2H3,(H,18,19)(H2,16,17,20)/t10-/m0/s1 |
| InChIKey | KRVHVJXEUOXCTL-JTQLQIEISA-N |
| XLogP | 2.01 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide?
The IUPAC name of (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide (CID 127039202) is (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide.
What is the SMILES notation for (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide?
The canonical SMILES for (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide is CC(C)C[C@H](NC(=O)Nc1c(F)cccc1F)C(=O)NO.
What is the InChIKey of (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide?
The InChIKey is KRVHVJXEUOXCTL-JTQLQIEISA-N. The full InChI is InChI=1S/C13H17F2N3O3/c1-7(2)6-10(12(19)18-21)16-13(20)17-11-8(14)4-3-5-9(11)15/h3-5,7,10,21H,6H2,1-2H3,(H,18,19)(H2,16,17,20)/t10-/m0/s1.
What are the key properties of (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide?
(2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide has a molecular weight of 301.29 g/mol, XLogP of 2.01, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2,6-difluorophenyl)carbamoylamino]-N-hydroxy-4-methylpentanamide is sourced from PubChem (CID 127039202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).