C21H29N5O2 — CID 127039506
2-[1-(3-methoxypropyl)piperidin-4-yl]-5-(3-propan-2-ylimidazo[1,5-a]pyridin-1-yl)-1,3,4-oxadiazole (PubChem CID 127039506) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-[1-(3-methoxypropyl)piperidin-4-yl]-5-(3-propan-2-ylimidazo[1,5-a]pyridin-1-yl)-1,3,4-oxadiazole.
| Compound Name | 2-[1-(3-methoxypropyl)piperidin-4-yl]-5-(3-propan-2-ylimidazo[1,5-a]pyridin-1-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 127039506 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 2-[1-(3-methoxypropyl)piperidin-4-yl]-5-(3-propan-2-ylimidazo[1,5-a]pyridin-1-yl)-1,3,4-oxadiazole |
| SMILES | COCCCN1CCC(c2nnc(-c3nc(C(C)C)n4ccccc34)o2)CC1 |
| InChI | InChI=1S/C21H29N5O2/c1-15(2)19-22-18(17-7-4-5-11-26(17)19)21-24-23-20(28-21)16-8-12-25(13-9-16)10-6-14-27-3/h4-5,7,11,15-16H,6,8-10,12-14H2,1-3H3 |
| InChIKey | IMDCOISNVLNWFP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|