C20H26O5 — CID 127039544
(1R,5aS,9aS)-10,11-dihydroxy-1-(hydroxymethyl)-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-naphtho[1,2-g][2]benzofuran-3-one (PubChem CID 127039544) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is (1R,5aS,9aS)-10,11-dihydroxy-1-(hydroxymethyl)-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-naphtho[1,2-g][2]benzofuran-3-one.
| Compound Name | (1R,5aS,9aS)-10,11-dihydroxy-1-(hydroxymethyl)-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-naphtho[1,2-g][2]benzofuran-3-one |
|---|---|
| PubChem CID | 127039544 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (1R,5aS,9aS)-10,11-dihydroxy-1-(hydroxymethyl)-6,6,9a-trimethyl-4,5,5a,7,8,9-hexahydro-1H-naphtho[1,2-g][2]benzofuran-3-one |
| SMILES | CC1(C)CCC[C@]2(C)c3c(O)c(O)c4c(c3CC[C@@H]12)C(=O)O[C@H]4CO |
| InChI | InChI=1S/C20H26O5/c1-19(2)7-4-8-20(3)12(19)6-5-10-13-14(11(9-21)25-18(13)24)16(22)17(23)15(10)20/h11-12,21-23H,4-9H2,1-3H3/t11-,12-,20-/m0/s1 |
| InChIKey | KBVVUWSGMLMTPO-PVUDRZGPSA-N |
| XLogP | 3.33 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|