C39H54N4O4 — CID 127039560
2-[6-[[5-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]hexyl]-5-(dimethylamino)isoindole-1,3-dione (PubChem CID 127039560) has the molecular formula C39H54N4O4 and a molecular weight of 642.89 g/mol. Its IUPAC name is 2-[6-[[5-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]hexyl]-5-(dimethylamino)isoindole-1,3-dione.
| Compound Name | 2-[6-[[5-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]hexyl]-5-(dimethylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 127039560 |
| Molecular Formula | C39H54N4O4 |
| Molecular Weight | 642.89 g/mol |
| Exact Mass | 642.41 |
| IUPAC Name | 2-[6-[[5-[3-(4-cyclohexylpiperazin-1-yl)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]hexyl]-5-(dimethylamino)isoindole-1,3-dione |
| SMILES | CN(C)c1ccc2c(c1)C(=O)N(CCCCCCOc1ccc3c(c1)CCCC3CCC(=O)N1CCN(C3CCCCC3)CC1)C2=O |
| InChI | InChI=1S/C39H54N4O4/c1-40(2)32-16-18-35-36(28-32)39(46)43(38(35)45)21-8-3-4-9-26-47-33-17-19-34-29(11-10-12-30(34)27-33)15-20-37(44)42-24-22-41(23-25-42)31-13-6-5-7-14-31/h16-19,27-29,31H,3-15,20-26H2,1-2H3 |
| InChIKey | PMADXNIXEGVGGP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.89 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|