C15H18N4O7 — CID 127039649
trans-(1R,2R)-4-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanoylhydrazinylidene]cyclopentane-1,2-dicarboxylic acid (PubChem CID 127039649) has the molecular formula C15H18N4O7 and a molecular weight of 366.33 g/mol. Its IUPAC name is trans-(1R,2R)-4-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanoylhydrazinylidene]cyclopentane-1,2-dicarboxylic acid.
| Compound Name | trans-(1R,2R)-4-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanoylhydrazinylidene]cyclopentane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 127039649 |
| Molecular Formula | C15H18N4O7 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | trans-(1R,2R)-4-[3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanoylhydrazinylidene]cyclopentane-1,2-dicarboxylic acid |
| SMILES | Cc1cn(CCC(=O)NN=C2C[C@@H](C(=O)O)[C@H](C(=O)O)C2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H18N4O7/c1-7-6-19(15(26)16-12(7)21)3-2-11(20)18-17-8-4-9(13(22)23)10(5-8)14(24)25/h6,9-10H,2-5H2,1H3,(H,18,20)(H,22,23)(H,24,25)(H,16,21,26)/t9-,10-/m1/s1 |
| InChIKey | GBUGMTFVHTXIFE-NXEZZACHSA-N |
| XLogP | -1.10 |
| TPSA | 170.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|