C18H22N4O3S — CID 127039840
(2Z)-2-[(E)-1-cyclohexylethylidenehydrazinylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 127039840) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is (2Z)-2-[(E)-1-cyclohexylethylidenehydrazinylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-[(E)-1-cyclohexylethylidenehydrazinylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 127039840 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (2Z)-2-[(E)-1-cyclohexylethylidenehydrazinylidene]-3-[(4-nitrophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | C/C(=N\N=C1/SCC(=O)N1Cc1ccc([N+](=O)[O-])cc1)C1CCCCC1 |
| InChI | InChI=1S/C18H22N4O3S/c1-13(15-5-3-2-4-6-15)19-20-18-21(17(23)12-26-18)11-14-7-9-16(10-8-14)22(24)25/h7-10,15H,2-6,11-12H2,1H3/b19-13+,20-18- |
| InChIKey | CLSFYAIKHLIYQT-CDOHVDKQSA-N |
| XLogP | 3.98 |
| TPSA | 88.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|