C15H26O3 — CID 127039859
(1S,5R,8S,9S)-1-(hydroxymethyl)-8-methyl-4-propan-2-ylspiro[4.5]dec-3-ene-8,9-diol (PubChem CID 127039859) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1S,5R,8S,9S)-1-(hydroxymethyl)-8-methyl-4-propan-2-ylspiro[4.5]dec-3-ene-8,9-diol.
| Compound Name | (1S,5R,8S,9S)-1-(hydroxymethyl)-8-methyl-4-propan-2-ylspiro[4.5]dec-3-ene-8,9-diol |
|---|---|
| PubChem CID | 127039859 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,5R,8S,9S)-1-(hydroxymethyl)-8-methyl-4-propan-2-ylspiro[4.5]dec-3-ene-8,9-diol |
| SMILES | CC(C)C1=CC[C@H](CO)[C@]12CC[C@](C)(O)[C@@H](O)C2 |
| InChI | InChI=1S/C15H26O3/c1-10(2)12-5-4-11(9-16)15(12)7-6-14(3,18)13(17)8-15/h5,10-11,13,16-18H,4,6-9H2,1-3H3/t11-,13+,14+,15-/m1/s1 |
| InChIKey | QWAJQOZHWOAWPW-UQOMUDLDSA-N |
| XLogP | 1.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|