C23H32N4O — CID 127039884
(1E,4E,6E)-1,7-bis(1-pentan-2-ylimidazol-2-yl)hepta-1,4,6-trien-3-one (PubChem CID 127039884) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is (1E,4E,6E)-1,7-bis(1-pentan-2-ylimidazol-2-yl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E,6E)-1,7-bis(1-pentan-2-ylimidazol-2-yl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 127039884 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (1E,4E,6E)-1,7-bis(1-pentan-2-ylimidazol-2-yl)hepta-1,4,6-trien-3-one |
| SMILES | CCCC(C)n1ccnc1/C=C/C=C/C(=O)/C=C/c1nccn1C(C)CCC |
| InChI | InChI=1S/C23H32N4O/c1-5-9-19(3)26-17-15-24-22(26)12-8-7-11-21(28)13-14-23-25-16-18-27(23)20(4)10-6-2/h7-8,11-20H,5-6,9-10H2,1-4H3/b11-7+,12-8+,14-13+ |
| InChIKey | HGGGSWYRMBTKSO-ZHHAIUQESA-N |
| XLogP | 5.65 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|