C16H16ClNO5 — CID 127040148
dimethyl (3aR,4S,6R,6aS)-3-(4-chlorophenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-4,6-dicarboxylate (PubChem CID 127040148) has the molecular formula C16H16ClNO5 and a molecular weight of 337.76 g/mol. Its IUPAC name is dimethyl (3aR,4S,6R,6aS)-3-(4-chlorophenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-4,6-dicarboxylate.
| Compound Name | dimethyl (3aR,4S,6R,6aS)-3-(4-chlorophenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-4,6-dicarboxylate |
|---|---|
| PubChem CID | 127040148 |
| Molecular Formula | C16H16ClNO5 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | dimethyl (3aR,4S,6R,6aS)-3-(4-chlorophenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-4,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC)[C@H]2ON=C(c3ccc(Cl)cc3)[C@H]21 |
| InChI | InChI=1S/C16H16ClNO5/c1-21-15(19)10-7-11(16(20)22-2)14-12(10)13(18-23-14)8-3-5-9(17)6-4-8/h3-6,10-12,14H,7H2,1-2H3/t10-,11+,12+,14+/m0/s1 |
| InChIKey | GJVWSFKRACHHRH-FMCLSXCISA-N |
| XLogP | 2.04 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |