C15H14N2O3 — CID 127040218
(1E,4E,6E)-1,7-bis(5-methyl-1,2-oxazol-3-yl)hepta-1,4,6-trien-3-one (PubChem CID 127040218) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is (1E,4E,6E)-1,7-bis(5-methyl-1,2-oxazol-3-yl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E,6E)-1,7-bis(5-methyl-1,2-oxazol-3-yl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 127040218 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (1E,4E,6E)-1,7-bis(5-methyl-1,2-oxazol-3-yl)hepta-1,4,6-trien-3-one |
| SMILES | Cc1cc(/C=C/C=C/C(=O)/C=C/c2cc(C)on2)no1 |
| InChI | InChI=1S/C15H14N2O3/c1-11-9-13(16-19-11)5-3-4-6-15(18)8-7-14-10-12(2)20-17-14/h3-10H,1-2H3/b5-3+,6-4+,8-7+ |
| InChIKey | YNCFFOCTNJMQPV-NKYSMPERSA-N |
| XLogP | 3.13 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|