About 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile
9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile (PubChem CID 127040272) has the molecular formula C23H19N5O
and a molecular weight of 381.44 g/mol. Its IUPAC name is 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile.
Molecular Properties
| Compound Name | 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile |
| PubChem CID | 127040272 |
| Molecular Formula | C23H19N5O |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile |
| SMILES | CCc1cc2c(cc1-c1cn[nH]n1)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O |
| InChI | InChI=1S/C23H19N5O/c1-4-13-8-16-17(9-15(13)19-11-25-28-27-19)23(2,3)22-20(21(16)29)14-6-5-12(10-24)7-18(14)26-22/h5-9,11,26H,4H2,1-3H3,(H,25,27,28) |
| InChIKey | QKYONSSKLFQUAK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile?
The IUPAC name of 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile (CID 127040272) is 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile.
What is the SMILES notation for 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile?
The canonical SMILES for 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile is CCc1cc2c(cc1-c1cn[nH]n1)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O.
What is the InChIKey of 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile?
The InChIKey is QKYONSSKLFQUAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N5O/c1-4-13-8-16-17(9-15(13)19-11-25-28-27-19)23(2,3)22-20(21(16)29)14-6-5-12(10-24)7-18(14)26-22/h5-9,11,26H,4H2,1-3H3,(H,25,27,28).
What are the key properties of 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile?
9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile has a molecular weight of 381.44 g/mol, XLogP of 4.26, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-6,6-dimethyl-11-oxo-8-(2H-triazol-4-yl)-5H-benzo[b]carbazole-3-carbonitrile is sourced from PubChem (CID 127040272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).