C30H44O7 — CID 127040424
[(1S,3R,5R,6aS,7R,8R,10aS)-1-acetyloxy-3-butanoyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] butanoate (PubChem CID 127040424) has the molecular formula C30H44O7 and a molecular weight of 516.68 g/mol. Its IUPAC name is [(1S,3R,5R,6aS,7R,8R,10aS)-1-acetyloxy-3-butanoyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] butanoate.
| Compound Name | [(1S,3R,5R,6aS,7R,8R,10aS)-1-acetyloxy-3-butanoyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] butanoate |
|---|---|
| PubChem CID | 127040424 |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | [(1S,3R,5R,6aS,7R,8R,10aS)-1-acetyloxy-3-butanoyloxy-7,8-dimethyl-7-(3-methylidenepent-4-enyl)-1,3,5,6,6a,8,9,10-octahydrobenzo[d][2]benzofuran-5-yl] butanoate |
| SMILES | C=CC(=C)CC[C@]1(C)[C@H](C)CC[C@@]23C(=C[C@H](OC(=O)CCC)C[C@@H]12)[C@@H](OC(=O)CCC)O[C@H]3OC(C)=O |
| InChI | InChI=1S/C30H44O7/c1-8-11-25(32)35-22-17-23-27(36-26(33)12-9-2)37-28(34-21(6)31)30(23)16-14-20(5)29(7,24(30)18-22)15-13-19(4)10-3/h10,17,20,22,24,27-28H,3-4,8-9,11-16,18H2,1-2,5-7H3/t20-,22+,24+,27+,28-,29-,30-/m1/s1 |
| InChIKey | BHYRXSDHULCRHK-XVOSQQLUSA-N |
| XLogP | 6.18 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|