About (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide
(2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide (PubChem CID 127040471) has the molecular formula C19H15IN2O
and a molecular weight of 414.25 g/mol. Its IUPAC name is (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide.
Molecular Properties
| Compound Name | (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide |
| PubChem CID | 127040471 |
| Molecular Formula | C19H15IN2O |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide |
| SMILES | C[n+]1ccc2c([nH]c3ccccc32)c1C(=O)c1ccccc1.[I-] |
| InChI | InChI=1S/C19H14N2O.HI/c1-21-12-11-15-14-9-5-6-10-16(14)20-17(15)18(21)19(22)13-7-3-2-4-8-13;/h2-12H,1H3;1H |
| InChIKey | AIEGFZHBPQHSHX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide?
The IUPAC name of (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide (CID 127040471) is (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide.
What is the SMILES notation for (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide?
The canonical SMILES for (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide is C[n+]1ccc2c([nH]c3ccccc32)c1C(=O)c1ccccc1.[I-].
What is the InChIKey of (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide?
The InChIKey is AIEGFZHBPQHSHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O.HI/c1-21-12-11-15-14-9-5-6-10-16(14)20-17(15)18(21)19(22)13-7-3-2-4-8-13;/h2-12H,1H3;1H.
What are the key properties of (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide?
(2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide has a molecular weight of 414.25 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-9H-pyrido[3,4-b]indol-2-ium-1-yl)-phenylmethanone iodide is sourced from PubChem (CID 127040471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).