C17H19NO5 — CID 127040499
dimethyl (3aR,4S,6R,6aS)-3-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-4,6-dicarboxylate (PubChem CID 127040499) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is dimethyl (3aR,4S,6R,6aS)-3-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-4,6-dicarboxylate.
| Compound Name | dimethyl (3aR,4S,6R,6aS)-3-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-4,6-dicarboxylate |
|---|---|
| PubChem CID | 127040499 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | dimethyl (3aR,4S,6R,6aS)-3-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazole-4,6-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](C(=O)OC)[C@H]2ON=C(c3ccc(C)cc3)[C@H]21 |
| InChI | InChI=1S/C17H19NO5/c1-9-4-6-10(7-5-9)14-13-11(16(19)21-2)8-12(17(20)22-3)15(13)23-18-14/h4-7,11-13,15H,8H2,1-3H3/t11-,12+,13+,15+/m0/s1 |
| InChIKey | JDCNIOMFRGIMFP-KYEXWDHISA-N |
| XLogP | 1.70 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |