C21H24O7 — CID 127040568
(1S,2S,7R,9R,13R,17S)-4,15-dimethoxy-2,17-dimethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-14-carbaldehyde (PubChem CID 127040568) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is (1S,2S,7R,9R,13R,17S)-4,15-dimethoxy-2,17-dimethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-14-carbaldehyde.
| Compound Name | (1S,2S,7R,9R,13R,17S)-4,15-dimethoxy-2,17-dimethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-14-carbaldehyde |
|---|---|
| PubChem CID | 127040568 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (1S,2S,7R,9R,13R,17S)-4,15-dimethoxy-2,17-dimethyl-3,11,16-trioxo-10-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-4,14-diene-14-carbaldehyde |
| SMILES | COC1=CC[C@@H]2C[C@H]3OC(=O)C[C@H]4C(C=O)=C(OC)C(=O)[C@H]([C@@]2(C)C1=O)[C@@]34C |
| InChI | InChI=1S/C21H24O7/c1-20-10(5-6-13(26-3)19(20)25)7-14-21(2)12(8-15(23)28-14)11(9-22)17(27-4)16(24)18(20)21/h6,9-10,12,14,18H,5,7-8H2,1-4H3/t10-,12+,14-,18-,20+,21-/m1/s1 |
| InChIKey | KXHIRQAQWBJGIS-CXKOCEMGSA-N |
| XLogP | 1.75 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|