C21H28O6 — CID 127040570
(1S,2S,4S,7R,9R,13R,17S)-4,15-dimethoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-14-ene-3,11,16-trione (PubChem CID 127040570) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is (1S,2S,4S,7R,9R,13R,17S)-4,15-dimethoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-14-ene-3,11,16-trione.
| Compound Name | (1S,2S,4S,7R,9R,13R,17S)-4,15-dimethoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-14-ene-3,11,16-trione |
|---|---|
| PubChem CID | 127040570 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (1S,2S,4S,7R,9R,13R,17S)-4,15-dimethoxy-2,14,17-trimethyl-10-oxatetracyclo[7.7.1.02,7.013,17]heptadec-14-ene-3,11,16-trione |
| SMILES | COC1=C(C)[C@@H]2CC(=O)O[C@@H]3C[C@H]4CC[C@H](OC)C(=O)[C@]4(C)[C@@H](C1=O)[C@@]32C |
| InChI | InChI=1S/C21H28O6/c1-10-12-9-15(22)27-14-8-11-6-7-13(25-4)19(24)20(11,2)18(21(12,14)3)16(23)17(10)26-5/h11-14,18H,6-9H2,1-5H3/t11-,12+,13+,14-,18-,20+,21-/m1/s1 |
| InChIKey | RLIZZPURPABKJH-HMEYXFAUSA-N |
| XLogP | 2.45 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |