C19H22ClN5OS — CID 127040594
6-chloro-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-methyl-2-(3-pyridin-2-yloxypropyl)pyrimidin-4-amine (PubChem CID 127040594) has the molecular formula C19H22ClN5OS and a molecular weight of 403.94 g/mol. Its IUPAC name is 6-chloro-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-methyl-2-(3-pyridin-2-yloxypropyl)pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-methyl-2-(3-pyridin-2-yloxypropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 127040594 |
| Molecular Formula | C19H22ClN5OS |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 6-chloro-N-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-5-methyl-2-(3-pyridin-2-yloxypropyl)pyrimidin-4-amine |
| SMILES | Cc1nc(C)c(CNc2nc(CCCOc3ccccn3)nc(Cl)c2C)s1 |
| InChI | InChI=1S/C19H22ClN5OS/c1-12-18(20)24-16(7-6-10-26-17-8-4-5-9-21-17)25-19(12)22-11-15-13(2)23-14(3)27-15/h4-5,8-9H,6-7,10-11H2,1-3H3,(H,22,24,25) |
| InChIKey | VXECAYIGMKDKPM-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|