C24H29NO6S — CID 127040758
diethyl 3,5-bis(4-methylphenyl)-1,1-dioxo-1,4-thiazinane-2,6-dicarboxylate (PubChem CID 127040758) has the molecular formula C24H29NO6S and a molecular weight of 459.56 g/mol. Its IUPAC name is diethyl 3,5-bis(4-methylphenyl)-1,1-dioxo-1,4-thiazinane-2,6-dicarboxylate.
| Compound Name | diethyl 3,5-bis(4-methylphenyl)-1,1-dioxo-1,4-thiazinane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 127040758 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | diethyl 3,5-bis(4-methylphenyl)-1,1-dioxo-1,4-thiazinane-2,6-dicarboxylate |
| SMILES | CCOC(=O)C1C(c2ccc(C)cc2)NC(c2ccc(C)cc2)C(C(=O)OCC)S1(=O)=O |
| InChI | InChI=1S/C24H29NO6S/c1-5-30-23(26)21-19(17-11-7-15(3)8-12-17)25-20(18-13-9-16(4)10-14-18)22(32(21,28)29)24(27)31-6-2/h7-14,19-22,25H,5-6H2,1-4H3 |
| InChIKey | NPPSMQZMRALFCW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |