C22H16F3NO3 — CID 127040870
4-[4-[[2-(Trifluoromethyl)phenyl]methylcarbamoyl]phenyl]benzoic acid (PubChem CID 127040870) has the molecular formula C22H16F3NO3 and a molecular weight of 399.40 g/mol. Its IUPAC name is 4-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[[2-(Trifluoromethyl)phenyl]methylcarbamoyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 127040870 |
| Molecular Formula | C22H16F3NO3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 4-[4-[[2-(trifluoromethyl)phenyl]methylcarbamoyl]phenyl]benzoic acid |
| SMILES | C1=CC=C(C(=C1)CNC(=O)C2=CC=C(C=C2)C3=CC=C(C=C3)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C22H16F3NO3/c23-22(24,25)19-4-2-1-3-18(19)13-26-20(27)16-9-5-14(6-10-16)15-7-11-17(12-8-15)21(28)29/h1-12H,13H2,(H,26,27)(H,28,29) |
| InChIKey | ZYAIXKNXUKOGEO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | 564 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |