C19H31N3 — CID 127040887
(1R,2R,3R,5S)-N-[(2-cyclopentyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine (PubChem CID 127040887) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is (1R,2R,3R,5S)-N-[(2-cyclopentyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,3R,5S)-N-[(2-cyclopentyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 127040887 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | (1R,2R,3R,5S)-N-[(2-cyclopentyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
| SMILES | C[C@@H]1[C@H]2C[C@@H](C[C@H]1NCc1cnc(C3CCCC3)[nH]1)C2(C)C |
| InChI | InChI=1S/C19H31N3/c1-12-16-8-14(19(16,2)3)9-17(12)20-10-15-11-21-18(22-15)13-6-4-5-7-13/h11-14,16-17,20H,4-10H2,1-3H3,(H,21,22)/t12-,14+,16-,17-/m1/s1 |
| InChIKey | YFSHBAPGVNVFHC-JWZBEHFJSA-N |
| XLogP | 4.23 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |