About [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol
[(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol (PubChem CID 127040907) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol |
| PubChem CID | 127040907 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol |
| SMILES | CC1=CC[C@@]2(CC1)C(C(C)C)=CC[C@@H]2CO |
| InChI | InChI=1S/C15H24O/c1-11(2)14-5-4-13(10-16)15(14)8-6-12(3)7-9-15/h5-6,11,13,16H,4,7-10H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | KJTBZKJQCOKDKN-HIFRSBDPSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol?
The IUPAC name of [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol (CID 127040907) is [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol.
What is the SMILES notation for [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol?
The canonical SMILES for [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol is CC1=CC[C@@]2(CC1)C(C(C)C)=CC[C@@H]2CO.
What is the InChIKey of [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol?
The InChIKey is KJTBZKJQCOKDKN-HIFRSBDPSA-N. The full InChI is InChI=1S/C15H24O/c1-11(2)14-5-4-13(10-16)15(14)8-6-12(3)7-9-15/h5-6,11,13,16H,4,7-10H2,1-3H3/t13-,15+/m1/s1.
What are the key properties of [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol?
[(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol has a molecular weight of 220.36 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-8-methyl-4-propan-2-ylspiro[4.5]deca-3,8-dien-1-yl]methanol is sourced from PubChem (CID 127040907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).