C30H25FN8O — CID 127040931
4-[[4-[(1-benzyl-2-methylbenzimidazol-5-yl)amino]-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenol (PubChem CID 127040931) has the molecular formula C30H25FN8O and a molecular weight of 532.58 g/mol. Its IUPAC name is 4-[[4-[(1-benzyl-2-methylbenzimidazol-5-yl)amino]-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenol.
| Compound Name | 4-[[4-[(1-benzyl-2-methylbenzimidazol-5-yl)amino]-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 127040931 |
| Molecular Formula | C30H25FN8O |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 4-[[4-[(1-benzyl-2-methylbenzimidazol-5-yl)amino]-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]phenol |
| SMILES | Cc1nc2cc(Nc3nc(Nc4ccc(O)cc4)nc(Nc4ccc(F)cc4)n3)ccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C30H25FN8O/c1-19-32-26-17-24(13-16-27(26)39(19)18-20-5-3-2-4-6-20)35-30-37-28(33-22-9-7-21(31)8-10-22)36-29(38-30)34-23-11-14-25(40)15-12-23/h2-17,40H,18H2,1H3,(H3,33,34,35,36,37,38) |
| InChIKey | ABCWFRVOCZSJLQ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|