C25H24FN5O5 — CID 127040940
1-(2-methyl-5-nitroimidazol-1-yl)propan-2-yl 4-[2-acetyl-5-(4-fluorophenyl)-3,4-dihydropyrazol-3-yl]benzoate (PubChem CID 127040940) has the molecular formula C25H24FN5O5 and a molecular weight of 493.50 g/mol. Its IUPAC name is 1-(2-methyl-5-nitroimidazol-1-yl)propan-2-yl 4-[2-acetyl-5-(4-fluorophenyl)-3,4-dihydropyrazol-3-yl]benzoate.
| Compound Name | 1-(2-methyl-5-nitroimidazol-1-yl)propan-2-yl 4-[2-acetyl-5-(4-fluorophenyl)-3,4-dihydropyrazol-3-yl]benzoate |
|---|---|
| PubChem CID | 127040940 |
| Molecular Formula | C25H24FN5O5 |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 1-(2-methyl-5-nitroimidazol-1-yl)propan-2-yl 4-[2-acetyl-5-(4-fluorophenyl)-3,4-dihydropyrazol-3-yl]benzoate |
| SMILES | CC(=O)N1N=C(c2ccc(F)cc2)CC1c1ccc(C(=O)OC(C)Cn2c([N+](=O)[O-])cnc2C)cc1 |
| InChI | InChI=1S/C25H24FN5O5/c1-15(14-29-16(2)27-13-24(29)31(34)35)36-25(33)20-6-4-19(5-7-20)23-12-22(28-30(23)17(3)32)18-8-10-21(26)11-9-18/h4-11,13,15,23H,12,14H2,1-3H3 |
| InChIKey | AMGFBSMVLAHKRN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 119.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|