C15H19NO3 — CID 127041075
[(3aR,4S,6S,6aS)-6-(hydroxymethyl)-3-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-4-yl]methanol (PubChem CID 127041075) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is [(3aR,4S,6S,6aS)-6-(hydroxymethyl)-3-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-4-yl]methanol.
| Compound Name | [(3aR,4S,6S,6aS)-6-(hydroxymethyl)-3-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 127041075 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | [(3aR,4S,6S,6aS)-6-(hydroxymethyl)-3-(4-methylphenyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-4-yl]methanol |
| SMILES | Cc1ccc(C2=NO[C@@H]3[C@H](CO)C[C@H](CO)[C@H]23)cc1 |
| InChI | InChI=1S/C15H19NO3/c1-9-2-4-10(5-3-9)14-13-11(7-17)6-12(8-18)15(13)19-16-14/h2-5,11-13,15,17-18H,6-8H2,1H3/t11-,12+,13-,15-/m1/s1 |
| InChIKey | YSKUXWDPZYQFFE-QVHKTLOISA-N |
| XLogP | 1.33 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |