C14H16FNO3 — CID 127041076
[(3aR,4S,6S,6aS)-3-(4-fluorophenyl)-6-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-4-yl]methanol (PubChem CID 127041076) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is [(3aR,4S,6S,6aS)-3-(4-fluorophenyl)-6-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-4-yl]methanol.
| Compound Name | [(3aR,4S,6S,6aS)-3-(4-fluorophenyl)-6-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 127041076 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | [(3aR,4S,6S,6aS)-3-(4-fluorophenyl)-6-(hydroxymethyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,2]oxazol-4-yl]methanol |
| SMILES | OC[C@@H]1C[C@H](CO)[C@@H]2C(c3ccc(F)cc3)=NO[C@H]12 |
| InChI | InChI=1S/C14H16FNO3/c15-11-3-1-8(2-4-11)13-12-9(6-17)5-10(7-18)14(12)19-16-13/h1-4,9-10,12,14,17-18H,5-7H2/t9-,10+,12-,14-/m1/s1 |
| InChIKey | BORVNZHSLFHUMU-IQOUGMIPSA-N |
| XLogP | 1.17 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |