About 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline
3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline (PubChem CID 127041142) has the molecular formula C19H10ClF6N
and a molecular weight of 401.74 g/mol. Its IUPAC name is 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline.
Molecular Properties
| Compound Name | 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline |
| PubChem CID | 127041142 |
| Molecular Formula | C19H10ClF6N |
| Molecular Weight | 401.74 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline |
| SMILES | FC(F)(F)c1cc(/C=C\c2cc3ccccc3nc2Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H10ClF6N/c20-17-13(9-12-3-1-2-4-16(12)27-17)6-5-11-7-14(18(21,22)23)10-15(8-11)19(24,25)26/h1-10H/b6-5- |
| InChIKey | WWQPNRYVJMBMMH-WAYWQWQTSA-N |
| XLogP | 7.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.74 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline?
The IUPAC name of 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline (CID 127041142) is 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline.
What is the SMILES notation for 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline?
The canonical SMILES for 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline is FC(F)(F)c1cc(/C=C\c2cc3ccccc3nc2Cl)cc(C(F)(F)F)c1.
What is the InChIKey of 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline?
The InChIKey is WWQPNRYVJMBMMH-WAYWQWQTSA-N. The full InChI is InChI=1S/C19H10ClF6N/c20-17-13(9-12-3-1-2-4-16(12)27-17)6-5-11-7-14(18(21,22)23)10-15(8-11)19(24,25)26/h1-10H/b6-5-.
What are the key properties of 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline?
3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline has a molecular weight of 401.74 g/mol, XLogP of 7.10, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-[3,5-bis(trifluoromethyl)phenyl]ethenyl]-2-chloroquinoline is sourced from PubChem (CID 127041142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).