C21H22F2N2O3 — CID 127041168
2,2-difluoro-N-[2-[5-(3-phenoxypropoxy)-1H-indol-3-yl]ethyl]acetamide (PubChem CID 127041168) has the molecular formula C21H22F2N2O3 and a molecular weight of 388.41 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-[5-(3-phenoxypropoxy)-1H-indol-3-yl]ethyl]acetamide.
| Compound Name | 2,2-difluoro-N-[2-[5-(3-phenoxypropoxy)-1H-indol-3-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 127041168 |
| Molecular Formula | C21H22F2N2O3 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2,2-difluoro-N-[2-[5-(3-phenoxypropoxy)-1H-indol-3-yl]ethyl]acetamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(OCCCOc3ccccc3)cc12)C(F)F |
| InChI | InChI=1S/C21H22F2N2O3/c22-20(23)21(26)24-10-9-15-14-25-19-8-7-17(13-18(15)19)28-12-4-11-27-16-5-2-1-3-6-16/h1-3,5-8,13-14,20,25H,4,9-12H2,(H,24,26) |
| InChIKey | VJIFRQNBXJQVIO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|